Because its an educated guess witch means its just a guess then you try to get the data that might support thats why it comes first
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Just here for the points sorry luv 2A.)true
Answer:
tundra
Explanation:
Obviously not: tropical, rainforest, rainforest temperate, and savanna.