Because if you change two things then you do not know which one has affected or altered the dependent variable. if you only change one then you know what exactly changed and why
This is true, this isn't a question, it's a fact.
Flower and sugar
flowers in sugar water? something along these lines
Answer:
helium family or neon family
Explanation:
you can use p
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
