Pseudo-science is not considered real science because it is not testable.
Answer: Option A
<u>Explanation:</u>
Pseudoscience primarily includes beliefs, theories or practices that are somehow incompatible with the scientific facts. The pseudoscience can’t be tested on the basis of science.
Let’s take an example of astrology. Some people believe that stars and other celestial bodies draw a significant impact on their life i.e. Good or bad thing it's just because their stars are working either in a positive or negative manner.
But, this belief doesn’t have any well-proved or authentic background over which the whole concept can rely on. Hence, pseudoscience is not taken as a real science as a lack of strong proves.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
they channel heat energy directly to the molecules (tiny particles) inside food. Microwaves heat food like the sun heats your face—by radiation. A microwave is much like the electromagnetic waves that zap through the air from TV and radio transmitters
Answer:
Explanation:
alright, dawg, lets get this bread. CHEMISTRY? OH YEAH I LOVE CHEMISTRY.
what is a mol? do you know who avogadro is? sounds like avocado. free shavocado. ok so you MUST REMEMBER THIS NUMBER PLEASE.
please remember this number and commit it to your memory: avogadros number
this is how much a mole is. you know how a pair is 2 and a dozen is 12? ok so a mole is it is confusing at first but hopefully this helps you to understand.
now that we understand this..... lets perform this calculation with a calculator
notice i divide the question by the avogadros number to find out how many moles are in the number. ok but listen... it gets into a tough area here... because HOW ARE WE TO DIVIDE SUCH A HUMONGOUS NUMBER BY ANOTHER HUMONGOUS NUMBER?!?!?
its easy, its cake, just listen this is how you do it. only focus on the numbers NOT the 10 exponential ones. so just 3.90 and 6.02 ok? lets divide these two numbers 3.90 / 6.02 and we get 0.6478... how interesting... ok now lets deal with the exponents of 10. notice that we are DIVIDING these numbers so think of it as subtracting the exponents of ten..... 22 minus 23 equals -1
so we have 
now this negative 1 thing is annoying so lets just make it to the power of 0
and anything to the power of 0 just becomes 1.
0.06478
so this is our answer but keep in mind we need 3 sig figs. if we round then we get 0.0648
put this into scientific notation we get
The second option only.
<h3>Explanation</h3>
A base neutralizes an acid when the two reacts to produce water and a salt.
Sulfuric acid H₂SO₄ is the acid here. There are more than one classes of bases that can neutralize H₂SO₄. Among the options, there are:
Metal hydroxides
Metal hydroxides react with sulfuric acid to produce water and the sulfate salt of the metal.
.
The formula for calcium sulfate 
in option A is spelled incorrectly. Why? The charge on each calcium 
is +2. The charge on each sulfate ion 
is -2. Unlike 
ions, it takes only one ion to balance the charge on each ion. As a result, and ions in calcium sulfate exist on a 1:1 ratio.
.
Ammonia, NH₃
Ammonia NH₃ can also act as a base and neutralize acids. NH₃ exists as NH₄OH in water:
.
The ion 
acts like a metal cation. Similarly to the metal hydroxides, NH₃ (or NH₄OH) neutralizes H₂SO₄ to produce water and a salt:
.
The formula of the salt (NH₄)₂SO₄ in the fourth option spelled the ammonium ion incorrectly.
As part of the salt (NH₄)₂SO₄, the ammonium ion NH₄⁺ is one of the products of this reaction and can't neutralize H₂SO₄ any further.
