1answer.
Ask question
Login Signup
Ask question
All categories
  • English
  • Mathematics
  • Social Studies
  • Business
  • History
  • Health
  • Geography
  • Biology
  • Physics
  • Chemistry
  • Computers and Technology
  • Arts
  • World Languages
  • Spanish
  • French
  • German
  • Advanced Placement (AP)
  • SAT
  • Medicine
  • Law
  • Engineering
docker41 [41]
3 years ago
11

8 Cakes cost £4.00 how much 3 cakes cost?

Mathematics
2 answers:
Bogdan [553]3 years ago
8 0
Well 8 cakes is 4.00 so that means each cakes is .50 right? so .50*e is 1.50
Diano4ka-milaya [45]3 years ago
4 0
8 cakes ... £4.00
3 cakes ... £x = ?

If you would like to know how much 3 cakes cost, you can calculate this using the following steps:

8 * x = 3 * 4
8 * x = 12    /8
x = 12/8
x = £3/2 = £1.5

Result: 3 cakes cost £1.5.
You might be interested in
Solve for m<br> 3m-4=5m+10
Sonbull [250]

Answer:

-7

Step-by-step explanation:

3m-4=5m+10

-2m-4=10

-2m=14

m=-7

7 0
3 years ago
Read 2 more answers
Please help due soon!!!
butalik [34]

Hey there!


Question #1.
2^6 + (2^3)^3

= 64 + (8)^3

= 64 + 8^3

= 64 + 512

= 576


Therefore, the answer should be:

Option A. 576


Question #2.
11^-4 * 11^8

= 1/14,641 * 214,358,881

= 14,641

≈ 11^4

Therefore, the answer should be:

Option C. 11^4


Good luck on your assignment & enjoy your day!


~Amphitrite1040:)

3 0
2 years ago
Read 2 more answers
HELP QUICK! You must find all intervals<br> where f(x) is negative. <br> f(x)=2(x+3)(x-7)
beks73 [17]

Answer:

any # where -2<=x<7

Step-by-step explanation:

(x-7) would be negative and (x+3) positive, resulting in f(x) being negative.

4 0
2 years ago
Find the six trig function values of the angle 240*Show all work, do not use calculator
-BARSIC- [3]

Solution:

Given:

240^0

To get sin 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, sin 240 will be negative.

sin240^0=sin(180+60)

Using the trigonometric identity;

sin(x+y)=sinx\text{ }cosy+cosx\text{ }siny

Hence,

\begin{gathered} sin(180+60)=sin180cos60+cos180sin60 \\ sin180=0 \\ cos60=\frac{1}{2} \\ cos180=-1 \\ sin60=\frac{\sqrt{3}}{2} \\  \\ Thus, \\ sin180cos60+cos180sin60=0(\frac{1}{2})+(-1)(\frac{\sqrt{3}}{2}) \\ sin180cos60+cos180sin60=0-\frac{\sqrt{3}}{2} \\ sin180cos60+cos180sin60=-\frac{\sqrt{3}}{2} \\  \\ Hence, \\ sin240^0=-\frac{\sqrt{3}}{2} \end{gathered}

To get cos 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, cos 240 will be negative.

cos240^0=cos(180+60)

Using the trigonometric identity;

cos(x+y)=cosx\text{ }cosy-sinx\text{ }siny

Hence,

\begin{gathered} cos(180+60)=cos180cos60-sin180sin60 \\ sin180=0 \\ cos60=\frac{1}{2} \\ cos180=-1 \\ sin60=\frac{\sqrt{3}}{2} \\  \\ Thus, \\ cos180cos60-sin180sin60=-1(\frac{1}{2})-0(\frac{\sqrt{3}}{2}) \\ cos180cos60-sin180sin60=-\frac{1}{2}-0 \\ cos180cos60-sin180sin60=-\frac{1}{2} \\  \\ Hence, \\ cos240^0=-\frac{1}{2} \end{gathered}

To get tan 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, tan 240 will be positive.

tan240^0=tan(180+60)

Using the trigonometric identity;

tan(180+x)=tan\text{ }x

Hence,

\begin{gathered} tan(180+60)=tan60 \\ tan60=\sqrt{3} \\  \\ Hence, \\ tan240^0=\sqrt{3} \end{gathered}

To get cosec 240 degrees:

\begin{gathered} cosec\text{ }x=\frac{1}{sinx} \\ csc240=\frac{1}{sin240} \\ sin240=-\frac{\sqrt{3}}{2} \\  \\ Hence, \\ csc240=\frac{1}{\frac{-\sqrt{3}}{2}} \\ csc240=-\frac{2}{\sqrt{3}} \\  \\ Rationalizing\text{ the denominator;} \\ csc240=-\frac{2}{\sqrt{3}}\times\frac{\sqrt{3}}{\sqrt{3}} \\  \\ Thus, \\ csc240^0=-\frac{2\sqrt{3}}{3} \end{gathered}

To get sec 240 degrees:

\begin{gathered} sec\text{ }x=\frac{1}{cosx} \\ sec240=\frac{1}{cos240} \\ cos240=-\frac{1}{2} \\  \\ Hence, \\ sec240=\frac{1}{\frac{-1}{2}} \\ sec240=-2 \\  \\ Thus, \\ sec240^0=-2 \end{gathered}

To get cot 240 degrees:

\begin{gathered} cot\text{ }x=\frac{1}{tan\text{ }x} \\ cot240=\frac{1}{tan240} \\ tan240=\sqrt{3} \\  \\ Hence, \\ cot240=\frac{1}{\sqrt{3}} \\  \\ Rationalizing\text{ the denominator;} \\ cot240=\frac{1}{\sqrt{3}}\times\frac{\sqrt{3}}{\sqrt{3}} \\  \\ Thus, \\ cot240^0=\frac{\sqrt{3}}{3} \end{gathered}

5 0
1 year ago
Hello!!! What is the square root of 35???
saveliy_v [14]

Answer:

sqrt(35) ≈5.916079783

Step-by-step explanation:

sqrt(35)

35 = 5*7

Neither of these numbers is a perfect square so

sqrt(35) cannot be simplified

it can be approximated

sqrt(35) ≈5.916079783

8 0
3 years ago
Read 2 more answers
Other questions:
  • Help! I need this one to past
    13·1 answer
  • Ms. tucker travels through two intersections with traffic lights as she drives to the market. the traffic lights operate indepen
    5·1 answer
  • For about $1 billion in new space shuttle expenditures, NASA has proposed to install new heat pumps, power heads, heat exchanger
    8·1 answer
  • Eliijah used 3/4 on his phone his memory on his phone can hold up to 32 gigabytes how many gigsbytes is he use
    5·1 answer
  • The inverse variation equation shows the relationship between wavelength in meters, x, and frequency, y.
    7·2 answers
  • Terrell is moving boxes in a freight elevator. Each box weighs about 25 pounds. For safety reasons, a maximum of 600 pounds can
    11·1 answer
  • Can someone pls help me?
    9·1 answer
  • 1. Solve the compound inequality. You do not need to graph the solution.
    12·1 answer
  • How do you solve an equation that looks like this?
    13·2 answers
  • Please help I'll give brainliest if answer is right ​
    15·1 answer
Add answer
Login
Not registered? Fast signup
Signup
Login Signup
Ask question!