Answer:
The answer is c( to send signals to control the body)
Answer:
6 moles of Oxygen required
Answer:
The amount of ionization in solution.
Explanation:
Strong acids ionize fully in solution to release a large number of hydrogen ions responsible for the acidic properties. On the contrary weak acids ionize partially in solution.
In strong acids less energy is required to break the hydrogen- anion bonds.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Explanation:
Hello!
In this case, considering the given table, we are able to represent the symbolic rate law as shown below:
Thus, by using the following steps, we can find both m (BF3 order of reaction) and n (BF3 order of reaction):
- Experiment 1 and 2 for the calculation of n:
So we plug in to obtain:
So the order of reaction with respect to NH3 is 1.
- Experiment 3 and 4 for the calculation of m
So we plug in to obtain:
So the order of reaction with respect to BF3 is also 1.
Now, we can compute the rate constant by solving for it on any of the experiments there, say experiment 1:
Thus, the initial reaction rate for the 0.50M BF3 and 0.020M NH3 is:
Best regards!