All categories

3 years ago

The products in a decomposition reaction ____.

Chemistry

1 answer:

Damm [24]3 years ago

8 0

Produces multiple products from a single reactant.

You might be interested in

Aluminum metal reacts with aqueous cobalt(II) nitrate to form aqueous aluminum nitrate and cobalt metal. What is the stoichiomet

Lelu [443]

Answer:

the stoichiometric coefficient for cobalt is 3

Explanation:

the unbalanced reaction would be

Co(NO₃)₂+ Al → Al(NO₃)₃ + Co

One way to solve is to build a system of linear equations for each element (or group as NO₃) , knowing that the number of atoms of each element is conserved.

For smaller reactions a quick way to solve it can be:

- First the Co as product and as reactant needs to have the same stoichiometric coefficient

- Then the Al as product and as reactant needs to have the same stoichiometric coefficient

- After that we look at the nitrates . There are 2 as reactants and 3 as products . Since the common multiple is 6 then multiply the reactant by 3 and the product by 2.

Finally the balanced equation will be

3 Co(NO₃)₂+ 2 Al → 2 Al(NO₃)₃ + 3 Co

then the stoichiometric coefficient for cobalt is 3

7 0

4 years ago

In Experiment 9, a 1.05 g sample of a mixture of NaCl (MW 58.45) and NaNO2 (MW 69.01) is reacted with excess sulfamic acid. The

Kaylis [27]

Answer:

There is 76.6 mL of nitrogen collected

Explanation:

Step 1: Data given

Mass of the sample = 1. 05 grams

The sample is 40.00% by mass NaNO2

MW of NaCl = 58.45 g/mol

MW of NaNO2 = 69.01 g/mol

Temperature = 22.0 °C

Pressure = 750.0 mmHg = (750/760) atm

The vapor pressure of water at 22.0°C is 19.8 mm Hg = 0.02605 atm

Step 2: Calculate mass of NaNO2

(40/100)*1.05 = 0.42 grams

Step 3: Calculate moles of NaNO2

Moles NaNO2 = 0.42 grams / 69.01 g/mol

Moles NaNO2 = 0.00608 moles

Step 4: Calculate moles of N2

For 2 moles of NaNO2 we'll get 1 mol of N2

For 0.00608 moles of NaNO2 we'll get 0.00608/2 = 0.00304 moles

Step 5: Calculate pressure of N2

P = 750.0 - 19.8 = 730.2 mmHg = (730.2/760)atm = 0.96079 atm = 97352 Pa

Step 6: Calculate volume of N2

PV = nRT

⇒ P = the pressure of N2 = 0.96079

⇒ V = the volume of N2 = TO BE DETERMINED

⇒ n = moles of N2 = 0.00304 moles

⇒ R = the gas constant = 0.08206 L*atm/K*mol

⇒ T = the temperature = 22°C = 295 Kelvin

V = (0.00304*0.08206*295)/0.96079

V = 0.0766 L = 76.6 mL

There is 76.6 mL of nitrogen collected

4 0

4 years ago

If the total mass of the products of a reaction is 90 gram, what was the total mass of the reactants

Marizza181 [45]

90 grams due to laws of conservation of mass. Output mass = input mass. Mass can never be created or destroyed.

4 0

3 years ago

A group of people take a diet pill. After 3 months, they measure the amount of weight they lost.

iris [78.8K]

dependent variable I think

8 0

4 years ago

Read 2 more answers

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago