Answer:the second one
Explanation:,Hydrogen bonding is a special type of dipole-dipole attraction between molecules ,not a covalent bond to a hydrogen atom. It results from the attractive force between a hydrogen atom covalently bonded to a very electronegative atom such as a N, O, or F atom and another very electronegative atom.
Statement #2 does not correctly compare boron to copper. B Boron is a semi metal so it can conduct electricity however metals (like Cu copper) are much better conductors of electricity.
Answer:
Small holes in plants that allow carbon dioxide in and oxygen and water vapor out
Explanation:
Stomata are tiny holes that open and close for the plant to breathe.
Point source, not a non source
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent