All categories

4 years ago

How does the statement opposites attract apply to the ions in ionic compounds

1 answer:

vladimir1956 [14]4 years ago

4 0

The ionic bond. This involves ions of opposite charge. Eelectrostatically charged bodies with opposite charges, + and -, attract one another. I hope this helps

You might be interested in

What keeps the planets in orbit in our solar system

son4ous [18]

Gravitational pull coming from the sun

7 0

2 years ago

Draw the alcohol that is the product of the reduction of 3-methylpentanal.

natali 33 [55]

Answer: The product from the reduction reaction is

CH3-CH2-CH(CH3)-CH2-CH2OH

IUPAC name; 3- Methylpentan-1-ol

Explanation:

Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.

Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal

CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;

3-methylpenta-1-ol .

The structure of the product is:

CH3-CH2-CH(CH3)-CH2-CH2OH

7 0

4 years ago

What is erosion by precipitation?

expeople1 [14]

"High-intensity" storms produce larger drops that fall faster than those of "low-intensity"storms and therefore have greater ability to destroy and dislodge particles from the soil matrix.
Hope that helped :)

5 0

3 years ago

I need it done assapp

Alja [10]

Answer:

water molecules

Explanation:

4 0

3 years ago

Read 2 more answers

What is the empirical formula of a compound with a percent composition of 22.5% Phosphorous and 77.5% Chlorine?

sashaice [31]

Answer:

$\boxed {\boxed {\sf PCl_3}}$

Explanation:

We are given the percent composition: 22.5% phosphorus and 77.5% chlorine.

We can assume there are 100 grams of this compound. We choose 100 because we can simply use the percentages as the masses.

22.5 g P
77.5 g Cl

Next, convert these masses to moles, using the molar masses found on the Periodic Table.

P: 30.974 g/mol
Cl: 35.45 g/mol

Use the molar masses as ratios and multiply by the number of grams. $22.5 \ g \ P * \frac {1 \ mol \ P }{30.974 \ g \ P}= \frac {22.5 \ mol \ P }{ 30.974} = 0.7264157035 \ mol \ P$

$77.5 \ g \ Cl * \frac {1 \ mol \ Cl }{35.45 \ g \ Cl}= \frac {77.5 \ mol \ Cl }{ 35.45} \ =2.186177715 \ mol \ Cl$

Divide both of the moles by the smallest number of moles to find the mole ratio.

$\frac {0.7264157035} {0.7264157035} = 1$

$\frac {2.186177715}{0.7264157035}=3.009540824 \approx 3$

The mole ratio is about 1 P: 3 Cl, so the empirical formula is written as:<u> PCl₃</u>

4 0

3 years ago