Atomic mass silicon = 28.085 u
1 mol Si ---------------- 28.085 g
? ------------------------ 245 g
245 x 1 / 28.085 => 8.72 mol
answer A
Answer:
Explanation:
Hello there!
In this case, since perchloric acid is HClO4 and is a strong acid and calcium hypochlorite is Ca(ClO)2, the undergoing molecular chemical reaction turns out:
Thus, since the resulting hypochlorous acid is weak, it does not fully ionize, so it remains unionized, however, we can write the ions for the other species:
Now, we can cancel out the spectator ions, calcium and perchlorate, to obtain:
Best regards!
The simple tissues are parenchyma, sclerenchyma and collenchyma. Chlorenchyma is a parenchyma, having chloroplast. It is a simple permanent tissue, having chloroplast.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
