Answer:
If the substance is a liquid or solid, production of an odor would indicate a chemical change.
Explanation:
First you need to balance the equation. Ba(OH)2+2HNO3=Ba(NO3)2+H2O. Then you can get the ratio of mole number of the reactants. The ratio is Ba(OH)2:HNO3=1:2. So the molarity of Ba(OH)2 is 38.5*0.85/2/20=0.82 molar.
Formula of isocyanic acid is HNCO. It colourless, volatile compound. It is poisonous inorganic compound. Melamine is synthesized from urea. The reaction involves two steps. In first step, urea gets converted to isocyanic acid which is an intermediate. In the second step, isocyanic acid gives melamine (molecular formula C₃H₆N₆) and carbon dioxide (CO₂). The balanced chemical reaction involved in second step is given below:
6 HNCO → 1 C₃N₃(NH₂)₃ + 3CO₂
The co-efficient of the reaction are: 6, 1, 3
Answer:
1
Explanation:
the answer is the first option because it's at less of an incline than the others, hope this helps!