Answer: True
Step-by-step explanation: Because if we have two independent events and want to know the probability of their happening at the same time, we multiply the two probabilities together. "Two events happening at the same time" is a compound event. We more often see this as "P(xy)," the probability of x AND y.
True
<span>Cos(A+B)=CosACosB-SinASinB
therefore Cos(A+A)= CosACosA - SinASinA
= Cos^2A - Sin^2A</span>
First of all, let's convert all the measures to the same unit: 4 feet are 48 inches.
Now, as the wheel turns, there is a proportion between the angle and the distance travelled: for example, when the car moves forward a whole circumference, the angle will be 360°. Conversely, if the wheel turns 180°, then the car will move forward a distance which is half the circumference of the wheel, and so on.
Since the radius is 16 inches, the circumference will be

So, we have the following proportion:

that you can read as: "if an angle of 360 corresponds to a distance travelled of
, then the unknown angle x corresponds to a distance travelled of 48 inches.
Solving for x, we have

Answer:
Pythagorean theorem, eh?
Step-by-step explanation:
The way to do this is use the radius-tangent angle theorem thing...
It states that, a radius that intersects a point of tangency(I think that's what it's called) is perpendicular to the tangent. Thus, CW is perpendicular to OW!
Thus, it forms a right triangle, where we can use Pythagorean Theorem!
If you don't know what it is, check the internet! It's pretty simple.

So, there you go! Hope this helps!
NOTE: This answer was recently deleted for violating community guidelines, so I just re-uploaded it!(and edited it) So if you do need more help, do some research!