The answer is a as it is balanced and has the shown molecules
Answer:
pH = 8.92
Explanation:
To solve this question we must know that the reaction of KOH with HC3H5O2 is:
KOH + HC3H5O2 → H2O + KC3H5O2
At equivalence point, all propanoic acid reacts to produce KC3H5O2.
This KC3H5O2 = C3H5O2⁻ is in equilibrium in water as follows:
C3H5O2⁻(aq) + H₂O(l) → OH⁻(aq) + HC3H5O2(aq)
<em>Where Kb = Kw / ka = 1x10⁻¹⁴/ 1.34x10⁻⁵ = 7.46x10⁻¹⁰</em>
is defined as:
Kb = 7.46x10⁻¹⁰ = [OH⁻] [HC3H5O2] / [C3H5O2⁻]
As both [OH⁻] [HC3H5O2] ions comes from the same equilibrium,
[OH⁻] = [HC3H5O2] = X
[C3H5O2⁻] is:
<em>Moles KOH = Moles </em>C3H5O2⁻:
0.0325L * (0.15mol / L) = 0.004875 moles
In 32.5 + 20mL = 52.5mL = 0.0525L:
0.004875 moles / 0.0525L = 0.09286M.
Replacing:
7.46x10⁻¹⁰ = [X] [X] / [0.09286M]
6.927x10⁻¹¹ = X²
X = 8.323x10⁻⁶M = [OH-]
As pOH = -log [OH-]
pOH = 5.08
pH = 14 -pOH
<h3>pH = 8.92</h3>
Answer:
You can see that it is an endothermic reaction or heat is being absorbed for the change from magnesium to magnesium oxide. So it is an endothermic reaction. So these are the four reasons why we can say that burning of magnesium ribbon in the air is considered a chemical change.
Explanation:
hope it help
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
