Cos(x/3)cos(x/3)=1/2(1+cos(2x/3))
2 answers:
You might be interested in
The effective rate of interest will be 9.10 %.
<h3>What is compound interest?</h3>
Compound interest is applicable when there will be a change in principle amount after the given time period.
Let's say you have given 100 for two years with a 10% rate of interest annually than for the second-year principle amount will become 110 instant of 100.
Given for simple interest
Principle amount = $650
Rate of interest = 12%
Time period = 7 months.
Interest= PRT/100
Interest= 650× 12 × 7/100 = 546
So final amount = 650 + 546 = $1196
By compound interest
1196 = 650
R = 9.10%
Hence the effective rate of interest will be 9.10%.
For more information about compound interest,
#SPJ1