Answer:
a) 727.5 kJ
Explanation:
Step 1: Data given
Mass of the piece of copper = 6.22 kg
Initial temperature of the copper = 20.5 °C
Final temperature of the copper = 324.3 °C
Specific heat of copper = 0.385 J/g°C
Step 2:
Q = m*c*ΔT
⇒ with Q = heat transfer (in J)
⇒ with m = the mass of the object (in grams) = 6220 grams
⇒ with c = the specific heat capacity = 0.385 J/g°C
⇒ with ΔT = T2 -T1 = 324.3 - 20.5 = 303.8
Q = 6220 grams * 0.385 J/g°C * 303.8 °C
Q = 727509.9 J = 727.5 kJ
b) This heat capacity is the heat capacity given for a copper at a temperature of 25°C
Give the compound a mass of 100 grams, so that the mass of each element is
C=52.14% of 100g = 52.14g
H=13.13g
O=34.73g
convert the mass to moles
divide the mole value by the smallest number of moles calculated
round to nearest whole number, this is the mole ratio / subscripts
Answer:
Yes you can use alligation for a type of liquid. Explanation: Alligation is an old and practical method of solving arithmetic problems related to mixtures of ingredients.
Answer:
step1
NH4NO3(s)+H2O(I)---------><u>NH⁴</u><u>O</u><u>H</u><u>(</u><u>aq</u><u>)</u><u>+</u><u>HNO³</u><u>(</u><u>aq</u><u>)</u>
<u>step²</u>
<u>NH⁴</u><u>O</u><u>H</u><u>(</u><u>aq</u><u>)</u><u>+</u><u>HNO</u><u>³</u><u>(</u><u>aq</u><u>)</u><u>-</u><u>-</u><u>-</u><u>-</u><u>-</u><u>-</u><u>-</u><u>-</u><u>></u><u>NH⁴</u><u>+</u><u>(</u><u>aq</u><u>)</u><u>+</u><u>NO³</u><u>-</u><u>(</u><u>aq</u><u>)</u><u>+</u><u>H²</u><u>O</u><u>(</u><u>I</u><u>)</u>
Answer:An atom consists of three sub atomic particles which are protons, neutrons, and electrons. Protons have a positive charge, neutrons have no charge, and electrons have a negative charge.
Explanation: because atoms are made up of particles