Answer:
6) 1. Crossing over: crossing over can mean any number of things. It could mean transforming, like making a change, or something as silly as crossing a bridge. In biological terms, it means transforming onto another stage, like a caterpillar making a chrysalis so it can cross over ino the final stage of its life: a beautiflul butterfly.
2. Its during the S phase when the chromosomes are replicated also they significant cell growth occurs.
7) 1. The parent cell in mitosis starts out as a diploid cell and it splits into two haploid daughter cells.
2. diploid spores that undergo meiosis.
8) I don’t know
9) 1. Sex cells have half a set of chromosomes, 23, while parent cells have 46.
Explanation: that all the answer there but for number 8 it look like the same question but uh..., hope this help
Demonstrate how to use the balance that students will be using to measure the mass of the cube. Record the mass of the cube in grams (g). Show students how to calculate density<span> by dividing the mass by the volume. Point out that the answer will be in grams per cubic centimeter (g/cm</span>3<span>).</span>
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
