All categories

3 years ago

Why is water necessary for living organisms?

2 answers:

7 0

I believe the correct answer from the choices listed above is the third option. Water is necessary for living organisms because all organisms need water to transport chemicals into their cells. Hope this answers the question. Have a nice day.

Finger [1]3 years ago

3 0

The answer is: All organisms need water to transport chemicals into their cells.

For example, supplies the body with oxygen and nutrients, and picks up carbon dioxide wastes.

The blood transports:

1) oxygen from the lungs to the cells of the body.

2) carbon(IV) oxide from metabolism to the lungs, where it is exhaled.

3) nutrients, transports hormones and removes waste products.

You might be interested in

Arrange the components of the electron transport chain in order from least electronegative to most electronegative thereby indic

choli [55]

The least electronegative component in the electron transport chain is the Hydrogen ion.
The more electronegative is NAD+
The other component is H2O,
Next are the energy carrier molecules which are the ADP and ATP
And finally, the most electronegative is O2.

3 0

3 years ago

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago

How do cells use lipids and carbohydrates?

Nata [24]

Answer:

Animals tend to use carbohydrates primarily for short-term energy storage, while lipids are used more for long-term energy storage. Carbohydrates are stored as glycogen in animals while lipids are stored as fats (in plants carbohydrates are stored as cellulose and lipids as oils)

Explanation:

hope this helps!

8 0

3 years ago

Read 2 more answers

Solid carbon tetrachloride, CCl4(s), is represented by the diagram above. The attractions between the CCl4 molecules that hold t

Ne4ueva [31]

Hi, you've asked an incomplete question. Here's the diagram that completes the question.

Answer:

(B) nonpolar covalent bonds

Explanation:

This structure in the diagram rightly fits the description of a non-covalent bond because there is an equal sharing of electrons of Carbon (C) and Chlorine (Cl).

Remember too that these elements are in their solid-state, hence the CCl4 (carbon tetrachloride) molecules are held strongly together.

7 0

3 years ago

PbSO4 has a Ksp = 1.3 * 10-8 (mol/L)2.

Oduvanchick [21]

i. The dissolution of PbSO₄ in water entails its ionizing into its constituent ions:

$\mathrm{PbSO_{4}}(aq) \rightleftharpoons \mathrm{Pb^{2+}}(aq)+\mathrm{SO_4^{2-}}(aq).$

---

ii. Given the dissolution of some substance

$xA{(s)} \rightleftharpoons yB{(aq)} + zC{(aq)}$ ,

the Ksp, or the solubility product constant, of the preceding equation takes the general form

$K_{sp} = [B]^y [C]^z$ .

The concentrations of pure solids (like substance A) and liquids are excluded from the equilibrium expression.

So, given our dissociation equation in question i., our Ksp expression would be written as:

$K_{sp} = \mathrm{[Pb^{2+}] [SO_4^{2-}]}$ .

---

iii. Presumably, what we're being asked for here is the molar solubility of PbSO4 (at the standard 25 °C, as Ksp is temperature dependent). We have all the information needed to calculate the molar solubility. Since the Ksp tells us the ratio of equilibrium concentrations of PbSO4 in solution, we can consider either [Pb2+] or [SO4^2-] as equivalent to our molar solubility (since the concentration of either ion is the extent to which solid PbSO4 will dissociate or dissolve in water).

We know that Ksp = [Pb2+][SO4^2-], and we are given the value of the Ksp of for PbSO4 as 1.3 × 10⁻⁸. Since the molar ratio between the two ions are the same, we can use an equivalent variable to represent both:

$1.3 \times 10^{-8} = s \times s = s^2 \\s = \sqrt{1.3 \times 10^{-8}} = 1.14 \times 10^{-4} \text{ mol/L}.$

So, the molar solubility of PbSO4 is 1.1 × 10⁻⁴ mol/L. The answer is given to two significant figures since the Ksp is given to two significant figures.

8 0

3 years ago