Answer:
$10618.37
Step-by-step explanation:
Use the formula for compound interest:
P(t) = P_0e^(rt)
You can look the formula up online to find what each variable represents.
First, our principal amount (P) is 10,000. Our interest rate (r) is 3% and our time (t) is 2. Substitute these into the equations in each variables' place. The equation will look like this:
P(t) = 10,000e^(0.03x2)
P(t) = 10,000e^(0.06)
Note that e is approximately 2.7183 .
Using your calculator, now simply find P(t).
You should get 10618.36972 as your answer. Round that to the nearest cent to get $10618.37 .
It's the last answer. Think about when you move a point on a graph left 4 spaces it's on the x axis. Because it's going left it's going towards the negative numbers hence minus and not plus. some concept for the y axis.
Answer:
Step-by-step explanation:
We need the chart or other information.
Step-by-step explanation:
If you put into a calculator "Sin(6)+Cos(6)+3Sin(2)Cos(2)", you get 1.20368506925. Hope that helps
Answer:
They are similar because Since all the sides are equal in each triangle, the ratio of corresponding sides will all be equal
Step-by-step explanation:
