Answer:
You cite them correctly and that the statistics are real.
Explanation:
Answer:
Your answer is B. It refers to the language used to create and format Web pages.
Explanation:
HTML stands for "Hyper Text Markup Language", which is a specification used on any webpage, ever. It was created by Sir Tim Berners-Lee in late 1991 and was officially released in 1995. This language is actually what is sent to your browser, which then interprets it and allows you to see the pretty pictures of Brainly.com! As of right now, HTML is at it's 5th revision, also known as HTML5, which is another term you'll see around.
Thanks, let me know if this helped!
Answer
Its for the purpose of maintenance and readability
Explanation
A presentation-oriented markup web application generates interactive web pages containing various types of markup language.
Markup is a language designed for the purposes of processing definition and presentation. It specifies code for formatting, both the layout and style, within a text file. Markup describes the structure while the styling is how it looks. it uses the code to specify the formatting which are called tags.
Answer:
No you can not tell that recursion is ever required to solve a problem.
Recursion is required when in the problem, the solution of the input depends on the solution of the subsets of the input.
Iteration is also another form of repetitive approach we follow to solve that kind of problems.
But the difference between recursion and iteration is :
- In recursion we call the function repeatedly to return the result to next level.
- In iteration certain bunch of instructions in a loop are executed until certain conditions met.
Explanation:
For example in the Fibonacci sequence problem, to find
, we need to compute
and
before that.
- In case of recursion we just call the method Fibonacci(n) repeatedly only changing the parameter Fibonacci(n-1), that calculates the value and return it.
Fibonacci(n)
1. if(n==0 or n==1)
2. return 1.
3.else
4. return( Fibonacci(n-1)+Fibonacci(n-1) )
- But in case of iteration we run a loop for i=2 to n, within which we add the value of current
and
to find the value of 
Fibonacci(n)
1. if(n<=2)
2. result = 1
3. else
4. result1 =1 and result2=1.
5. { result = result1 +result2.
6. result1= result2.
7. result2 = result.
8. }
9. output result.