Answer: -3
Step-by-step explanation:
It could mean
1. simple interest
2. compound interest
1.simple interest
so just 8% of that 700 is added on
find 8% of 700
8% of 700=0.08 times 700=0.56
6 years=0.56 times 6=3.36
add
3.36+700=703.36
2. compound interst
that means the each year, it gives you 8% on that new thing
so
8%=0.08
so each year, it is multiplied by 1.08 since you add the original (1) to the 8% 0.08
so
6 years means
700 times 1.08^6=700 times 1.08 times 1.08 times 1.08 times 1.08 times 1.08 times 1.08=1110.81
answers are
if simple interest=$703.36
if compound interst=$1110.81
The cosine repeats itself every 360 degrees, and it mirrors at 0 and 180 degrees. It inverts around 90 and 270.
So without using a calculator, you can tell that:
cos(520)=cos(520-360)=cos(160)
cos(160) = cos(180-20) = cos(180+20) = cos(200)
cos(160) is NOT equal to cos(20), it would be -cos(20).
cos(160) = -cos(20) = -cos(-20)
So C is the only one unequal.
Be more specific! What is your question?
Answer: The charge would be $7.20.
hope that helps.
