Explanation
NaCl: Ionic crystal lattice forces
Hg: Metallic bonding
CO₂: London dispersion forces
CH₄: London dispersion forces
Li₂O: Ionic crystal lattice forces
Ag: Metallic bonds
Ionic crystal lattice forces are strong electrostatic force of attraction between oppositely charged ions arranged into a crystal lattice of ionic compound. NaCl and Li₂O are ionic compounds
London dispersion forces holds the molecules of carbon dioxide and methane. They are weak attractions found between non-polar (and polar) molecules.
Metallic bonds exists between Mercury and Gold atoms. This is due to sea of electrons present.
Answer:
a straight line passing from side to side through the center of a body or figure, especially a circle or sphere.
Explanation:
a straight line passing from side to side through the center of a body or figure, especially a circle or sphere.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The moon is what makes currents so if there was no moon there would be no current in our oceans. The way it makes currents is from the gravitational pull.
Brainliest? :)
