Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
<span>Ask the teacher for instructions.</span>
It has four main components: plasma, red blood cells, white blood cells, and platelets. Blood has many different functions, including: transporting oxygen and nutrients to the lungs and tissues. forming blood clots to prevent excess blood loss.
<span>The right side of your heart receives blood from the body and pumps it to the lungs. The left side of the heart does the exact opposite: It receives blood from the lungs and pumps it out to the body. Blood that travels from the lungs to the body contains oxygen from the lungs. Blood that travels from the body to the right side of the heart contains CO2 which is breathed out when it gets to the lungs.</span>
Answer:
C.) Sepal, Petal, Stamen, Carpel
Explanation:
