3 years ago

What kind of reaction is Mercury (11) oxide

2 answers:

4 0

Answer:

2HgO --> 2Hg + O2 is a decomposition reaction, in which mercury oxide is decomposed into the element mercury and oxygen gas. A decomposition reaction is one in which a more complex substance is broken down into its simpler components.

Hope this helps!

Morgarella [4.7K]3 years ago

3 0

That would be a decomposition reaction

You might be interested in

What is one result of a chemical change?

laila [671]

B. A new material is formed

4 0

3 years ago

Based on this diagram, which type of stars would belong to spectral class M and have the

mixas84 [53]

Answer:J , the answer is super giants

6 0

2 years ago

What does non polar mean?

Hoochie [10]

When atoms bond together to form molecules, they share or give electrons. If the electrons are shared equally by the atoms, then there is no resulting charge and the molecule is nonpolar.

8 0

3 years ago

Can someone help me I would really appreciate it

slega [8]

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

8 0

3 years ago

As ice melts and changes from solid to liquid, A) entropy increases. B) kinetic energy decreases. C) an exothermic reaction occu

Mazyrski [523]

Answer:

C) Because it gets hotter

3 0

3 years ago