Many of the actual chemicals in flower petals that give them their different colors are called anthocyanins. These are water-soluble compounds that belong to a bigger class of chemicals known as flavonoids. Anthocyanins are responsible for creating the colors blue, red, pink, and purple in flowers.
The correct answer would be the fourth option. A nucleotide consists of a phosphate group, a pentose sugar, and a nitrogen containing base that are all linked together by covalent bonds. Nucleotides are the monomer units of nucleic acids and is the basic unit of the DNA.
That would be phosphorus. It’s electron configuration is 1s^2 2s^2 2p^6 3s^2 3p^3
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
2.1648 kg of CH4 will generate 119341 KJ of energy.
Explanation:
Write down the values given in the question
CH4(g) +2 O2 → CO2(g) +2 H20 (g)
ΔH1 = - 802 kJ
2 H2O(g)→2 H2O(I)
ΔH2= -88 kJ
The overall chemical reaction is
CH4 (g)+2 O2(g)→CO2(g)+2 H2O (I) ΔH2= -890 kJ
CH4 +2 O2 → CO2 +2 H20
(1mol)+(2mol)→(1mol+2mol)
Methane (CH4) = 16 gm/mol
oxygen (O2) =32 gm/mol
Here 1 mol CH4 ang 2mol of O2 gives 1mol of CO2 and 2 mol of 2 H2O
which generate 882 KJ /mol
Therefore to produce 119341 KJ of energy
119341/882 = 135.3 mol
to produce 119341 KJ of energy, 135.3 mol of CH4 and 270.6 mol of O2 will require
=135.3 *16
=2164.8 gm
=2.1648 kg of CH4
2.1648 kg of CH4 will generate 119341 KJ of energy
