Answer:
260.34g
Explanation:
First, you need to know what angelic acid is comprised of. It is written as C₅H₈O₂.
In order to solve for the mass of 2.6 moles of angelic acid, you need the mass of 1 mole of angelic acid. This can be found by adding the masses from the periodic table, like shown below:
5 carbon atoms = (5)(12.01g) = 60.05g
8 hydrogen atoms = (8)(1.01) = 8.08g
2 oxygen atoms = (2)(16) = 32g
angelic acid = 60.05 + 8.08 + 32 = 100.13g
Then, set up a basic stoichiometric equation and solve. The units should cancel out.
The Eukaryotic cell has a nucleus
Answer:
3.6 per inch
EPS insulation features an average r-value of 3.6 per inch.
In addition to providing energy efficiency, EPS without film facers has a perm rating of up to 5.0.
Explanation:
hope this helps
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
There are several differences between a physical and chemical change in matter or substances. A physical change in a substance doesn't change what the substance is. In a chemical change where there is a chemical reaction, a new substance is formed and energy is either given off or absorbed.
