Answer:
it is turned into kinetic energy
Explanation:
The spectral line has been defined as the more or less number of photons in the spectrum that appears bright or dark. The electron jumping from n = 4 to 3 belongs to the Paschen series.
<h3>What is the Paschen series?</h3>
The Paschen series is the Infrared (I.R) region that has a number of lines estimating from higher energy levels to n = 3 energy levels. If the electron jumps from n = 4 to n = 3 then they have wavelengths of 1875 nm.
This wavelength has been found to lie in the IR region that emits electrons from the atom of hydrogen. The electron tends to move from higher energy states to lower energy states.
Therefore, the electron transition belongs to the Paschen series.
Learn more about the Paschen series, here:
brainly.com/question/17147448
#SPJ4
Answer:
The answer is A, if im not mistaken
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
Estuaries have more concentrated nutrients and less concentrated salt.