Explanation:
The answer is H2SO4 for sulphuric acid
Answer:
2 grams.
Explanation:
H2 + O2 ---> H2O2
Using molar masses:
2*1 g hydrogen reacts with 2*16 g oxygen.
so 2g H2 reacts with 32 g O2.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer : The amount of heat evolved by a reaction is, 4.81 kJ
Explanation :
Heat released by the reaction = Heat absorbed by the calorimeter + Heat absorbed by the water
![q=[q_1+q_2]](https://tex.z-dn.net/?f=q%3D%5Bq_1%2Bq_2%5D)
![q=[c_1\times \Delta T+m_2\times c_2\times \Delta T]](https://tex.z-dn.net/?f=q%3D%5Bc_1%5Ctimes%20%5CDelta%20T%2Bm_2%5Ctimes%20c_2%5Ctimes%20%5CDelta%20T%5D)
where,
q = heat released by the reaction
= heat absorbed by the calorimeter
= heat absorbed by the water
= specific heat of calorimeter = 
= specific heat of water = 
= mass of water = 254 g
= change in temperature = 
Now put all the given values in the above formula, we get:
![q=[(783J/^oC\times -2.28^oC)+(254g\times 4.184J/g^oC\times -2.28^oC)]](https://tex.z-dn.net/?f=q%3D%5B%28783J%2F%5EoC%5Ctimes%20-2.28%5EoC%29%2B%28254g%5Ctimes%204.184J%2Fg%5EoC%5Ctimes%20-2.28%5EoC%29%5D)

Therefore, the amount of heat evolved by a reaction is, 4.81 kJ