The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Molecular geometry Vsepr
According to VSEPR, the valence electron pairs surrounding an atom mutually repel each other; they adopt an arrangement that minimizes this repulsion, thus determining the molecular geometry. This means that the bonding (and non-bonding) electrons will repel each other as far away as geometrically possible.
Explanation:
Answer:
2. The metal would lose one electrons and the non metal would gain one electrons
Explanation:
An atom of a certain element reacts with the atoms of other elements in order to fullfill its outermost shell (called valence shell).
We notice the following:
- The elements in Group 1 (which are metals) have only 1 electron in their valence shell
- The elements in Group 17 (which are non-metals) have 1 vacancy (lack of electron) in their valence shell
This means that in order for both an atom of group 1 and an atom of group 17 to fullfill the valence shell, they have to:
- The atom in group 1 has to give away its only electron of the valence shell
- The atom in group 17 has to gain one electron in order to fullfill the shell
Therefore, the correct option is
2. The metal would lose one electrons and the non metal would gain one electrons
I would use a conversation calculator