Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: water
Explanation:if you look at a globe most of it is blue and blue on a globe is water so that means water covers most of the earth
Answer:
we have two loops in our body in which blood circulates. One is oxygenated, meaning oxygen rich, and the other is deoxygenated, which means it has little to no oxygen, but a lot of carbon dioxide.
One molecule of ammonia is composed of two atoms of nitrogen and three atoms of hydrogen. Option B.
<h3>What is an equation?</h3>
The term chemical equation has to do with the presentation of a chemical reaction on paper in a way that it can be easily understood. It is easy to write an equation to show what is going on in a reaction system.
Now we have the reactions as shown in the question. In this reaction which is the synthesis of ammonia and occurs industrially in the Haber process. The statement that is not true is that; one molecule of ammonia is composed of two atoms of nitrogen and three atoms of hydrogen. Option B.
Learn more about chemical equation:brainly.com/question/28294176
#SPJ1
