All categories

2 years ago

If you bike for 3 hours at 10 mph and then walk for 1hr at 2mph, what would be your average speed

Mathematics

1 answer:

stiv31 [10]2 years ago

8 0

Answer:

it depends how fat you are....BUT the average speed would be 8 I THINK but i might be right

Step-by-step explanation:

You might be interested in

Will give brainliest if helpful!!!!! :)

dolphi86 [110]

Answer:

I hope this help

Step-by-step explanation:

I hope this help

7 0

2 years ago

Read 2 more answers

Use the "rule of 72" to estimate the doubling time (in years) for the interest rate, and then calculate it exactly. (Round your

bonufazy [111]

Answer:

Using the rule of 72, the doubling time is 9.35 years.

The exact answer is that the doubling time is 8.89 years.

Step-by-step explanation:

By the rule of 72, we have that the doubling time D is given by:

$D = \frac{72}{Interest Rate}$

The interest rate is in %.

In our exercise, the interest rate is 7.7%. So, by the rule of 72:

$D = \frac{72}{7.7} = 9.35$ .

Exact answer:

The exact answer is going to be found using the compound interest formula(since the rule of 72 is a simplification of this formula).

The compound interest formula is given by:

$A = P(1 + \frac{r}{n})^{nt}$

Where A is the amount of money, P is the principal(the initial sum of money), r is the interest rate(as a decimal value), n is the number of times that interest is compounded per unit t and t is the time the money is invested or borrowed for.

So, for this exercise, we have:

We want to find the doubling time, that is, the time in which the amount is double the initial amount, double the principal.

$A = 2P$

$r = 0.077$

There are 52 weeks in a year, so $n = 52$

$A = P(1 + \frac{r}{n})^{nt}$

$2P = P(1 + \frac{0.077}{52})^{52t}$

$2 = (1.0015)^{52t}$

Now, we apply the following log propriety:

$\log_{a} a^{n} = n$

So:

$\log_{1.0015}(1.0015)^{52t} = \log_{1.0015} 2$

$52t = 462.44$

$t = \frac{462.44}{52}$

$t = 8.89$

The exact answer is that the doubling time is 8.89 years.

6 0

3 years ago

What is the current value of a zero-coupon bond that pays a face value of $1,000 at maturity in 6 years if the appropriate disco

Zolol [24]

Answer:4

Step-by-step explanation:

A zero-coupon bond doesn’t make any payments. Instead, investors purchase the zero-coupon bond for less than its face value, and when the bond matures, they receive the face value.

To figure the price you should pay for a zero-coupon bond, you'll follow these steps:

Divide your required rate of return by 100 to convert it to a decimal.

Add 1 to the required rate of return as a decimal.

Raise the result to the power of the number of years until the bond matures.

Divide the face value of the bond to calculate the price to pay for the zero-coupon bond to achieve your desired rate of return.

First, divide 4 percent by 100 to get 0.04. Second, add 1 to 0.04 to get 1.04. Third, raise 1.04 to the sixth power to get 1.2653. Lastly, divide the face value of $1,000 by 1.2653 to find that the price to pay for the zero-coupon bond is $790,32.

5 0

3 years ago

Which of the following statements are true for sin (-430°)

stira [4]

Answer:

Step-by-step explanation:

sin(-430)=-sin(430)=-sin(360+70)=-sin 70

8 0

2 years ago

Please help me I <br><img src="https://tex.z-dn.net/?f=%20%7Bx%7D%5E%7B2%7D%20%20-%20%20%7By%7D%5E%7B2%7D%20%20%2B%204y%20-%204"

Ivenika [448]

Answer: