All categories

2 years ago

La Base de un triangulo mide 28 cm y su altura es correspondiente, 3/7 cm de la base. calculen el area del triangulo

Mathematics

1 answer:

nikklg [1K]2 years ago

5 0

Answer:

168 cm²

Step-by-step explanation:

altura = 3/7 × 28 = 12 cm

area = ½×28×12 = 168 cm²

You might be interested in

Please help. I don’t understand how to do this

Rasek [7]

Greetings from Brasil...

Let's apply the given formula:

A = (1/2)·B·H

The base of this polygon (in this case, the triangle) is B

B = X² - 2X + 6

The height of this polygon is H and is H

H = X + 4

Applying these values (B and H) in the given formula.....

A = (1/2)·B·H

A = (1/2)·(X² - 2X + 6)·(X + 4)

A = (1/2)·(X³ + 2X² - 2X + 24)

A = (X³/2) + X² - X + 12

A = (X³ + 2X² - 2X + 24)/2

4 0

2 years ago

Read 2 more answers

Sin230° = _____<br><br> -sin50°<br> sin50°<br> sin130°

likoan [24]

Sin230=sin(180+50)=sin180cos50+cos180sin50=-sin50 answer 1

8 0

2 years ago

If an object is projected upward from ground level with an initial velocity of 128 ft per sec, then it's height in feet after t

antoniya [11.8K]

Answer: t= 4 seconds

Maximum height = 256 feet

Step-by-step explanation:

The height of the object projected upwards after t seconds is given by

s(t)=-16t^2+128t.

The expression is a quadratic equation. When this equation is plotted on a graph, height against time, it takes the shape of a parabola whose vertex represents the maximum height attained by the object.

To get the value of t at the maximum height,

t = -b/2a

From the equation,

a = -16

b = 128

t = -128/-2×-16

= -128 /- 32= 4

it will take 4 seconds to reach its maximum height

To find maximum height attained, put t= 4 in the equation

s(t)=-16t^2+128t

S = -16× 4^2 + 128×4

S = -256+512

S = 256 feet

3 0

3 years ago

Beginning one month after birth of their son, Noah, the Nelsons deposited $100 each month in an annuity for his college fund. Th

gizmo_the_mogwai [7]

Answer:

$100 * (1 + 6.8%/12)^216 + $100*(1+6.8%/12)^215 + ... + $100*(1+6.8%/12)^1

Now note that

x + x^2 + x^3 + ... + x^N = x ( 1 + x + ... + x^(N-1) )

= x ( (x^N -1)/(x-1) )

Here, x = 1+6.8%1 = 1.00566666 and N = 216, so

$100 * ( 1.00566666 ( 1.00566666^216 -1) / 0.00566666 )

= $ 42398.33

The total interest earned is $42,398 - $21,600 = $20,798

Step-by-step explanation:

The generic formula used in this compound interest calculator is V = P(1+r/n)^(nt)

V = the future value of the investment

P = the principal investment amount

r = the annual interest rate

n = the number of times that interest is compounded per year

t = the number of years the money is invested for

8 0

3 years ago

PLEASE HELP! I can't figure it out:(

raketka [301]

For team one is (fg), (s), (pat) and 0 and for team two is (td), (td), (pat), (s) im honestly confused with this because it dosent have a quenstion

7 0

2 years ago