This process is called aerobic respiration.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
The boiling point decreases as the volume decreases.
Explanation:
The Temperature - Volume law otherwise called as Charles law is applied, which says that the volume of the given gas at constant pressure is directly proportional to the temperature measured in Kelvin. As the volume increases, the temperature also increases, if the volume decreases, then the temperature also decreases.
As per the Charles law, here the volume is decreased from 50 ml to 25 ml so the boiling point also decreases.
Answer:
18 grams of water
Explanation:
The Balance Chemical Reaction is as follow,
2 NH₄NO₃ → 2 N₂ + O₂ + 4 H₂O
According to Equation,
160 g (2 moles) NH₄NO₃ produces = 72 g (4 moles) of H₂O
So,
40 g of NH₄NO₃ will produce = X g of H₂O
Solving for X,
X = (40 g × 72 g) ÷ 160 g
X = 18 g of H₂O
<em>Hope This Helps!</em>
The major drawback of fossil fuels is that they warm the planet i.e. they cause global warming.
The reaction typically gives off heat and light as well. The general equation for a complete combustion reaction is:
Fuel + O2 → CO2 + H2O + ENERGY
<h3>
Disadvantages of Fossil fuels</h3>
The term "fossil fuels" refers to flammable organic geologic formations, including dead organic matter that has been buried hundreds of feet beneath sediment.
- Fossil fuel emissions include various oxides, such as carbon, nitrogen, and sulfate, which cause acid rain and harm the soil's fertility and water quality.
- Both coal and petroleum burning discharge a significant amount of pollutants into the atmosphere, contributing to pollution levels.
- Gases like carbon dioxide are released through the burning of fossil fuels, which aids in climate change.
To view similar questions on Fossil fuels, refer to:
brainly.com/question/14339391
#SPJ4
