Answer:
The total number of atoms when glucose and oxygen reacts stays the same when carbondioxide and water are produced.
Explanation:
Chemical reaction:
C₆H₁₂O₆ + 6O₂ → 6CO₂ + 6H₂O
We can see that the number of atoms of each element remain same on both side of reaction so law of conservation of mass is followed by this reaction. Six number of carbon atoms twelve number of hydrogen atoms and eighteen number of oxygen atoms are present on both side.
There are two types of respiration:
1. Aerobic respiration
2. Anaerobic respiration
Aerobic respiration
It is the breakdown of glucose molecule in the presence of oxygen to yield large amount of energy. Water and carbon dioxide are also produced as a byproduct.
Glucose + oxygen → carbon dioxide + water + 38ATP
Anaerobic Respiration
It is the breakdown of glucose molecule in the absence of oxygen and produce small amount of energy. Alcohol or lactic acid and carbon dioxide are also produced as byproducts.
Glucose→ lactic acid/alcohol + 2ATP + carbon dioxide
This process use respiratory electron transport chain as electron acceptor instead of oxygen. It is mostly occur in prokaryotes. Its main advantage is that it produce energy (ATP) very quickly as compared to aerobic respiration.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
it means you have 4 sodium
Explanation: