Ionic compounds are formed by a positive ion called cation and a negative ion called anion.
I will show you some examples:
NaCl is formed by the cation Na+ and the anion Cl -
CaF2 is formed by the cation Ca 2+ and the anion F -
Li2O if formd by the cation Li + and the anion O 2-.
To tell that you use the oxidation number of each element. I did it this way
Ca F2 => Ca has oxidation number 2+ and F has oxidation number 1- then the ions have that very same charge number.
Explanation:
<h2>The three major branches of natural science are</h2><h2>1.Physical,the study of universe.</h2><h2>2.Chemistry,the study of matter.</h2><h2>3.Biology,the study of life and living or organisms.</h2><h2 /><h2>have a good day.</h2><h2>I hope this answer can help you</h2>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
<h2>⇒</h2>
two layers of different liquids=two phases.
Because oil doesn't dissolve in water. It only floats on water.
<em>-</em><em> </em><em>BRAINLIEST</em><em> answerer</em>