3 years ago

When is di- used in the name of a hydrocarbon?

1 answer:

6 0

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

You might be interested in

Which of these expressions are correct variations of the Combined Gas Law?

mafiozo [28]

Answer:

Both

Explanation:

The combined gas law is also known as the general gas law.

From the ideal gas law we assume that n = 1;

So;

PV = nRT

and then;

$\frac{P_{1}V_{1} }{T_{1} }$ = $\frac{P_{2}V_{2} }{T_{2} }$

If we cross multiply;

P₁V₁T₂ = P₂V₂T₁

So;

T₁ = $T_{2} \frac{P_{1}V_{1} }{P_{2} V_{2} }$

Also;

V₂ = $V_{1} \frac{P_{1} T_{2} }{P_{2} T_{1} }$

So from the choices both are correct

3 0

3 years ago

A 365 L balloon is blown up inside at 283 K. It is then taken outside in the hot sun and Heated to 300K. What is the new volume?

asambeis [7]

V₁ = initial Volume of the balloon after it is blown up = 365 L

V₂ = new Volume of the balloon after it is taken outside = ?

T₁ = initial temperature of the balloon = 283 K

T₂ = new temperature of the balloon = 300 K

using the equation

V₁/V₂ = T₁/T₂

365/V₂ = 283/300

V₂ = 387 L

6 0

4 years ago

knowing that the reaction of potassium in water is extremely exothermic, what would be the problem with adding a large piece of

anygoal [31]

Answer:

Explanation:

If the reaction is really exothermic (and it is) then the water would spatter all over the place. It would boil off if the container could hold it. It would also react according to the following reaction.

You are talking about a reaction like

2K + 2HOH = 2KOH + H2

8 0

3 years ago

This chemical reaction is unbalanced: ___Pb(NO₃)₂(aq) + ___Li₂SO₄(aq) → ____PbSO₄(s) + ____LiNO₃(aq) Which coefficient should ap

kakasveta [241]

Answer: 2

Explanation:

4 0

3 years ago

If I have 251.14 grams of citric acid and calcium bicarbonate mixture how much citrus acid do I have??

Snezhnost [94]

About 255.3 grams is the answer I believe. I just had a school work packet and had that question on it, and that is the answer that I had put on it I believe.

6 0

4 years ago