The compound of interest is: <span>CH3CH2-O-CH2CH2CH3
Above compound is an ether.
General name of this compound is ethyl propyl ether.
IUPAC name of the compound is methoxy propane. </span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
The pitch of a sound is related to its frequency.
Explanation:
The higher the frequency, the higher the pitch will be
Amplitude is related to how loud a sound is
Answer:
electronegativity increases
