You are actually giving 5 points. Ps I just got five points for telling you that
An atom that undergoes radioactive decay and has a large nucleus most likely contains....<span>- More protons than electrons.</span>
A combustion reaction is when a fuel, usually a hydrocarbon, reacts with excess oxygen to form carbon dioxide gas and water vapor.
Scientist typically use the international system of measurements, or the metric system. If you mean English as in England, then yes.<span> The United States' system of measurement is not usually used by scientists.</span>
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]