Answer:
The speed of a spound wave in this water is 1484.1 m/s
Explanation:
Step 1: Data given
Frequency = 349.2 Hz
Wavelength = 4.25 m
Step 2: Calculate the speed
v = f*λ
⇒ with v= the speed of a sound wave in this water
⇒ with f = the frequency = 349.2 Hz
⇒ with λ = the wavelength = 4.25 m
v = 349.2 Hz * 4.25 m = 1484.1 m/s
The speed of a spound wave in this water is 1484.1 m/s
Answer:
The egg white will represent the outer layer which is the we are located on!
Explanation:
There are <em>three</em> possibilities:
synthesis
redox (reduction/oxidation)
endothermic
Physicam because the size or form is changing not what its composed of
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
