Answer:
2Mg + O₂ → 2MgO
Explanation:
Chemical equation:
Mg + O₂ → MgO
Balanced chemical equation:
2Mg + O₂ → 2MgO
The balanced equation s given above and it completely follow the law of conservation of mass.
Law of conservation of mass:
According to the law of conservation mass, mass can neither be created nor destroyed in a chemical equation.
This law was given by french chemist Antoine Lavoisier in 1789. According to this law mass of reactant and mass of product must be equal, because masses are not created or destroyed in a chemical reaction.
Steps to balanced the equation:
Step 1:
Mg + O₂ → MgO
Mg = 1 Mg = 1
O = 2 O = 1
Step 2:
2Mg + O₂ → MgO
Mg = 2 Mg = 1
O = 2 O = 1
Step 3:
2Mg + O₂ → 2MgO
Mg = 2 Mg = 2
O = 2 O = 2
5.75 Grams per cm^3
You do mass divided by volume
The volume of the 0.279 M Ca(OH)₂ solution required to neutralize 24.5 mL of 0.390 M H₃PO₄ is 51.4 mL
<h3>Balanced equation </h3>
2H₃PO₄ + 3Ca(OH)₂ —> Ca₃(PO₄)₂ + 6H₂O
From the balanced equation above,
- The mole ratio of the acid, H₃PO₄ (nA) = 2
- The mole ratio of the base, Ca(OH)₂ (nB) = 3
<h3>How to determine the volume of Ca(OH)₂ </h3>
- Molarity of acid, H₃PO₄ (Ma) = 0.390 M
- Volume of acid, H₃PO₄ (Va) = 24.5 mL
- Molarity of base, Ca(OH)₂ (Mb) = 0.279 M
- Volume of base, Ca(OH)₂ (Vb) =?
MaVa / MbVb = nA / nB
(0.39 × 24.5) / (0.279 × Vb) = 2/3
9.555 / (0.279 × Vb) = 2/3
Cross multiply
2 × 0.279 × Vb = 9.555 × 3
0.558 × Vb = 28.665
Divide both side by 0.558
Vb = 28.665 / 0.558
Vb = 51.4 mL
Thus, the volume of the Ca(OH)₂ solution needed is 51.4 mL
Learn more about titration:
brainly.com/question/14356286
Answer:
Here's it:
Explanation:
Germs are everywhere! They can get onto hands and items we touch during daily activities and make us sick. Cleaning hands at key times with soap and water or hand sanitizer that contains at least 60% alcohol is one of the most important steps you can take to avoid getting sick and spreading germs to those around you.
There are important differences between washing hands with soap and water and using hand sanitizer. Soap and water work to remove all types of germs from hands, while sanitizer acts by killing certain germs on the skin. Although alcohol-based hand sanitizers can quickly reduce the number of germs in many situations, they should be used in the right situations.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
