Answer: 9000 - 1 significant figure
Explanation: Since you are multiplying, the number with the least amount of significant figures determines the number of significant figures in the answer. The number 9 has 1 significant figure and 1025 and has 4 significant figures so 9 has the fewest significant figures, meaning your answer will be 1 significant figure.
Answer:
A) H2O > HCCH > NH3 > CH3CH3
Explanation:
H2O is known as a neural compound which a pH close to 7.0. This however makes it more acidic due to it having the lowest pH when compared to the others in the option.
The other options however have their acidic strength as follows: HCCH > NH3 > CH3CH3. This explains why the pattern of decreasing acidic strength is H2O > HCCH > NH3 > CH3CH3
Examining the given reaction:
Li2O + H2O ........> 2LiOH
we find that, 1 mole of Li2O is required to react with one mole of H2O in order to produce two moles of LiOH.
Therefore, the ration between the required Li2O and H2O is 1:1
Based on this, 2.2 moles of H2O (water) are required to react with 2.2 moles of Li2O
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The starting substances of a chemical reaction are called the reactants, and the new substances that result are called the products.
