Answer: Most methods for making new elements involve a cyclotron, which speeds up atoms to high velocities before they smash into other atoms—these atoms are usually of different elements. This causes the nuclei to combine, creating new heavier elements.
Explanation: How are superheavy elements made?
If you add salt to water then it will boil faster than water without salt
The answer is: Plastic
Plastic is the result of the addition polymerization of poly(alkenes). Thus plastic is a synthetic organic material.
Hope it helped!
Answer:
ΔHrxn = - 1534.3 J
Explanation:
Given the assumptions and the formula for the change in enthalpy:
ΔHrxn = m x C x ΔT, where
m is the mass of solution given 135.4 g
C is the heat capacity 4.2 J/g .K and,
ΔT is the change in temperature
we have ,
T₁ = ( 18.1 + 273) K = 291.1 K
T₂ = ( 15.4 +273) K = 288.4 K
ΔHrxn = 135.3 g x 4.2 J/gK x ( 288.4 -291.1 ) K = - 1534.3 J
After verifying our result has the correct unit, the answer is -1534.3 Joules, and the negative sign tells us it is an endothermic reaction decreasing the final temperature.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs