Answer:
260.34g
Explanation:
First, you need to know what angelic acid is comprised of. It is written as C₅H₈O₂.
In order to solve for the mass of 2.6 moles of angelic acid, you need the mass of 1 mole of angelic acid. This can be found by adding the masses from the periodic table, like shown below:
5 carbon atoms = (5)(12.01g) = 60.05g
8 hydrogen atoms = (8)(1.01) = 8.08g
2 oxygen atoms = (2)(16) = 32g
angelic acid = 60.05 + 8.08 + 32 = 100.13g
Then, set up a basic stoichiometric equation and solve. The units should cancel out.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
To solve the problem, we assume the sample to be ideal. Then, we use the ideal gas equation which is expressed as PV = nRT. From the first condition of the nitrogen gas sample, we calculate the number of moles.
n = PV / RT
n = (98.7x 10^3 Pa x 0.01 m^3) / (8.314 Pa m^3/ mol K) x 298.15 K
n = 0.40 mol N2
At the second condition, the number of moles stays the same however pressure and temperature was changed. So, the new volume is calculated as follows:
V = nRT / P
V = 0.40 x 8.314 x 293.15 / 102.7 x 10^3
V = 9.49 x 10^-3 m^3 or 9.49 L
Answer:
A catalyst speeds up a chemical reaction, without being consumed by the reaction. It increases the reaction rate by lowering the activation energy for a reaction. ... Remember that with a catalyst, the average kinetic energy of the molecules remains the same but the required energy decreases
Explanation:
...
hope that is helpful
