3. they make up larger compounds like fats and amino acids, would be the correct answer.
Answer:
The last answer is right they get half of the mothers genes and half of the fathers genes.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
fluorine plus chlorides think
Lithium oxide is able to undergo both the processes of dissolution and dissociation.
Dissociation refers to the break down a chemical substance into its constituents. Ionization refers to the loss of electrons from a chemical specie while dissolving refers to the ability of a solid to form a solution.
Let us now look at each of the following species;
- Lithium oxide undergoes dissolution and dissociation.
- Magnesium nitride undergoes dissolution and dissociation.
- Hydrobromic acid undergoes dissolution and dissociation.
Learn more about ionization: brainly.com/question/1602374
