Answer:
Covalent bonds.
Explanation:
Diamond is organized in a giant lattice structure with strong covalent bonds between carbon atoms. Each carbon atom forms 4 bonds. Explanation: Each carbon atom has four electrons in its outer shell, all of which form covalent bonds that are strong and hard to break.
Answer:
p-fluoronitrobenzene and sodium phenoxide is more appropriate
Explanation:
An ipso substitution is required to form p-nitrophenyl phenyl ether.
For this ipso substitution, an alkoxide anion needs to attack as a nucleophile at the carbon atom attached to fluorine atom and thereby substitute that F atom.
p-nitrophenoxide is an weak nucleophile as compared to phenoxide due to presence of electron withdrawing resonating effect of nitro group at para position.
p-fluoronitrobenzene is a good choice for nucleophilic attack by alkoxide anion as compared to fluorobenzene due to higher positive charge density at carbon atom directly attached to F atom. Higher positive charge density arises due to presence of electron withdrawing resonating effect og nitro group at para position.
So, p-fluoronitrobenzene and sodium phenoxide is more appropriate
Because Celcius is a larger amount than Fahrenheit. The units are farther apart.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
One single covalent bond, hope this helps!