Answer:
Sodium hydrogencarbonate or sodium carbonate
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
It's a thermodynamic quantity equal to the enthalpy minus the product of entropy and the absolute temperature
The false positive from the response of hydrogen peroxide and the immunizing circle would be created by poor specificity. The recipe for specificity is TN/TN+FP. False-positive outcomes can be ascribed to meddling substances in nature where the strips are put away or utilized, for example, hydrogen peroxide (H2O2) or fade (hypochlorite).
