Answer:
increase in temperature of the intrinsic semiconductor
Explanation:
- If the p-side has a higher doping concentration, it implies that number of holes (positive ion) increased which is greater than number of electron (negative ion) in the n-side
- in order to balance the intrinsic concentration, that is to balance the number of holes and electrons which depends on temperature.
- an increase in the temperature of the intrinsic semiconductor (p-side), increases the number of electron but number of holes remains constant.
A balance in the intrinsic concentration helps in tuning to the same radio channel.
Friction <span>is most responsible for slowing a bicycle down when the brakes are applied</span>
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:
1.51 X 10^23 ions
Explanation:
The number of ions in 17.1 gm of aluminum sulphate Al2 (SO4)3 =….. [Molar mass of Al2 (SO4)3 = 342 gm]
in one molecule of Al2(SO4)3 there are 5 ions 2 aluminum and 3 sulfate ions
in 2 molecules there are 2X5= 10 ions
in 10 molecules there are 10X5 = 50 ions
molar mass of Al2(SO4)3 = (2 X 26.98) +( 3 X 32.1) + (3 X 4 X 16.0 ) =342.gms = 17.1/342 =0.0500 moles
1 mole =6.02 X 10^23 molecules ( see Avogadros number)
0.0500 moles = 0.0500 X 6.02 X 10^23 molecules =
0.301 X 10^23 molecules = 3.01 X 10^22 molecules
We determined that each molecule of Al2(SO4)3 has 5 ions
so 3.01 X10^22 molecules have 5 X 3.01 X 10^22 ions =
15.05 X 10^22 ions = 1.51 X 10^23 ions
An alp-ha particle is equivalent to the nucleus of a helium atom. Helium Atom = Answer.
