Answer:
It keeps us alive, helps us grow plants, helps plants thrive, gives us food, helps keep our animals and crops healthy, cleans us, and so much more
Explanation:
<u>Answer:</u>
<u>For a:</u> The chemical equation for the dissolution of sodium carbonate is 
<u>For b:</u> The net acid-base reaction is 
<u>Explanation:</u>
Dissolution reaction is defined as the reaction in which a solid compound gets dissolved in water to form aqueous solution.
The chemical equation for the dissolution of sodium carbonate follows:

Ionization reaction is defined as the reaction in which an ionic compound dissociates into its ions when dissolved in aqueous solution.
The chemical equation for the ionization of sodium carbonate follows:

Now, the anion formed which is
reacts with water to form conjugate acid.
The chemical equation for the reaction of anion with water follows:

Hence, the net acid-base reaction of the anion formed and water is written above.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
A
Explanation:
it causes the genes of two different individuals to mix
Answer: The answer is B
Explanation: Looking at the table given, the more wire loops you put on the nail, the more paperclips that it can hold. Meaning the electromagnet gets stronger the more loops you put on the nail