Answer:
The correct answer is B.
Explanation:
The molecule of water has 2 atoms of hydrogen and 1 atom of oxygen.
The ratio of masses are given as:

This illustrates the law of definite proportions which is also known as law of constant compositions .
The law states that 'the elements combining to form compound always combine in a fixed ratio by their mass.'
Whereas :
Law of multiple proportion states that when two elements combine with each other to form more than one compounds , the mass of one element with respect to the fixed mass of another element are in ratio of small whole numbers.
Law of conservation of mass states that mass can neither be created nor be destroyed but it can only be transformed from one form to another form.
In a balanced chemical reaction ,total mass on the reactant side must be equal to the total mass on the product side.
Law of conservation of energy states that energy can neither be created nor be destroyed but it can only be transformed from one form to another form.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
2 Carbon (C) is found on the Periodic Table; however, Carbon Dioxide (CO2) is not. Why is this the case? А B с D
A Only substances that cannot be broken down into simpler substances are found on the Periodic Table.
B Only gases are found on the Periodic Table.
C Only compounds are found on the Periodic Table.
D Compounds cannot be broken down into simpler substances.
Answer:
Explanation:
Hey there! :D
Look at the word hydrolysis. Hydro= water Lysis = split. (Root words)
So, water (in terms of the word) is added to help split and breakdown macromolecules.
I hope this helps!
~kaikers