Polysaccharides, that allow sugar to polymerize
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
4.0 moles
Explanation:
The following data were obtained from the question:
Volume (V) = 12L
Pressure = 5.6 atm
Temperature (T) = 205K
Gas constant (R) = 0.08206 atm.L/Kmol
Number of mole (n) =?
Using the ideal gas equation: PV = nRT, the number of mole of the gas can be obtained as follow
PV = nRT
5.6 x 12 = n x 0.08206 x 205
Divide both side by 0.08206 x 205
n = (5.6 x 12)/(0.08206 x 205)
n = 4.0 moles
Therefore, the number of mole of the gas is 4.0 moles
