Answer:
C
Explanation:
Temperature is directly related to kinetic energy (KE). As we raise temperature, we are raising KE, as well. Particles with more KE move more quickly and with more force.
This means that these particles are more likely to collide with each other and react to allow the chemical reaction to follow through. In turn, if the chemical reaction is more likely to go to completion, the reaction rate increases, eliminating A and B.
The concentration of the solute is not affected by the temperature; in other words, temperature will not increase or decrease the amount of solute in the solution, so eliminate D.
Thus the answer is C.
Hope this helps!
It's 10.
Mass = density x volume
M = 1g/ml(10ml) = 10g
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Action-at-a-Distance Forces. Frictional Force. Gravitational Force. Tension Force ... The force of gravity on earth is always equal to the weight of the object as ... The friction force is the force exerted by a surface as an object moves across it or ... The force of air resistance is often observed to oppose the motion of an object.
Explanation:
Answer:
ore is naturally occuring solid material from which a metal or valuable mineral can be extracted
profitably.