Just have to do antilog
[H+]= 10^-5.6
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The initial state of the compound Br2 is liquid. The final
state is then solid. We know for certain that the liquid state has higher energy
as compared to solid state. Due to this fact, Br2 must release energy to be in
solid form. Therefore, the change in enthalpy is:
ΔH = -7.4 kcal/nil
We can solve this problem using the long hand solution, wherein we 1 by 1 analyze the different equilibrium reactions or by simply using the Henderson Hasselbach equation. The equation is
pH = -log(pKa) + log (salt/acid)
since the acid and the salt have the same concentration, the log (salt/acid) term is equal to zero.
thus
pH = -log(1.73*10-5)
pH = 4.76
please be careful with the negative sign
Answer:
Explanation:
Hello,
In this case, since the acid is monoprotic, we can notice a 1:1 molar ratio between, therefore, for the titration at the equivalence point, we have:
Thus, solving for the moles of the acid, we obtain:
Then, by using the mass of the acid, we compute its molar mass:
Regards.
